2-methyl-N-(3-methylphenyl)-5-[5-(morpholine-4-carbonyl)-1,2,4-oxadiazol-3-yl]thiophene-3-sulfonamide
Chemical Structure Depiction of
2-methyl-N-(3-methylphenyl)-5-[5-(morpholine-4-carbonyl)-1,2,4-oxadiazol-3-yl]thiophene-3-sulfonamide
2-methyl-N-(3-methylphenyl)-5-[5-(morpholine-4-carbonyl)-1,2,4-oxadiazol-3-yl]thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | L824-1006 |
| Compound Name: | 2-methyl-N-(3-methylphenyl)-5-[5-(morpholine-4-carbonyl)-1,2,4-oxadiazol-3-yl]thiophene-3-sulfonamide |
| Molecular Weight: | 448.52 |
| Molecular Formula: | C19 H20 N4 O5 S2 |
| Smiles: | Cc1cccc(c1)NS(c1cc(c2nc(C(N3CCOCC3)=O)on2)sc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9073 |
| logD: | 2.9053 |
| logSw: | -3.3262 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 98.141 |
| InChI Key: | FPDUHIHDMCSLMA-UHFFFAOYSA-N |