3-[3-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]-5-(4-ethoxyphenyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-[3-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]-5-(4-ethoxyphenyl)-1,2,4-oxadiazole
3-[3-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]-5-(4-ethoxyphenyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | L829-0440 |
| Compound Name: | 3-[3-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]-5-(4-ethoxyphenyl)-1,2,4-oxadiazole |
| Molecular Weight: | 389.47 |
| Molecular Formula: | C22 H19 N3 O2 S |
| Smiles: | CCOc1ccc(cc1)c1nc(c2cccc(c2)c2csc(C3CC3)n2)no1 |
| Stereo: | ACHIRAL |
| logP: | 6.3066 |
| logD: | 6.3062 |
| logSw: | -5.746 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.753 |
| InChI Key: | ATYWVTKJNBNTRU-UHFFFAOYSA-N |