3-[3-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]-5-(3-fluorophenyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-[3-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]-5-(3-fluorophenyl)-1,2,4-oxadiazole
3-[3-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]-5-(3-fluorophenyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | L829-0495 |
| Compound Name: | 3-[3-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]-5-(3-fluorophenyl)-1,2,4-oxadiazole |
| Molecular Weight: | 363.41 |
| Molecular Formula: | C20 H14 F N3 O S |
| Smiles: | C1CC1c1nc(cs1)c1cccc(c1)c1nc(c2cccc(c2)F)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.9802 |
| logD: | 5.9797 |
| logSw: | -6.2289 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 41.63 |
| InChI Key: | VNYFLNIKHNDUMU-UHFFFAOYSA-N |