[1-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,4,6,7-tetrahydro-5H-pyrazolo[4,3-c]pyridin-5-yl](3-methylthiophen-2-yl)methanone
Chemical Structure Depiction of
[1-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,4,6,7-tetrahydro-5H-pyrazolo[4,3-c]pyridin-5-yl](3-methylthiophen-2-yl)methanone
[1-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,4,6,7-tetrahydro-5H-pyrazolo[4,3-c]pyridin-5-yl](3-methylthiophen-2-yl)methanone
Compound characteristics
| Compound ID: | L851-2392 |
| Compound Name: | [1-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,4,6,7-tetrahydro-5H-pyrazolo[4,3-c]pyridin-5-yl](3-methylthiophen-2-yl)methanone |
| Molecular Weight: | 405.48 |
| Molecular Formula: | C21 H19 N5 O2 S |
| Smiles: | Cc1ccsc1C(N1CCc2c(C1)c(c1nc(c3ccccc3)no1)nn2C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4971 |
| logD: | 3.4971 |
| logSw: | -3.6296 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 63.991 |
| InChI Key: | PZIIVRBPMWKWBL-UHFFFAOYSA-N |