N-[(4-methylphenyl)methyl]-2-(4-oxo-7-phenylpyrido[3',2':4,5]thieno[3,2-d]pyrimidin-3(4H)-yl)acetamide
					Chemical Structure Depiction of
N-[(4-methylphenyl)methyl]-2-(4-oxo-7-phenylpyrido[3',2':4,5]thieno[3,2-d]pyrimidin-3(4H)-yl)acetamide
			N-[(4-methylphenyl)methyl]-2-(4-oxo-7-phenylpyrido[3',2':4,5]thieno[3,2-d]pyrimidin-3(4H)-yl)acetamide
Compound characteristics
| Compound ID: | L858-1506 | 
| Compound Name: | N-[(4-methylphenyl)methyl]-2-(4-oxo-7-phenylpyrido[3',2':4,5]thieno[3,2-d]pyrimidin-3(4H)-yl)acetamide | 
| Molecular Weight: | 440.52 | 
| Molecular Formula: | C25 H20 N4 O2 S | 
| Smiles: | Cc1ccc(CNC(CN2C=Nc3c4ccc(c5ccccc5)nc4sc3C2=O)=O)cc1 | 
| Stereo: | ACHIRAL | 
| logP: | 4.5585 | 
| logD: | 4.5583 | 
| logSw: | -4.4552 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 58.007 | 
| InChI Key: | RWPKZPJSXJBEJO-UHFFFAOYSA-N | 
 
				 
				