3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(3-fluorophenyl)methyl]-7-methyl-1,8-naphthyridin-4(1H)-one
Chemical Structure Depiction of
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(3-fluorophenyl)methyl]-7-methyl-1,8-naphthyridin-4(1H)-one
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(3-fluorophenyl)methyl]-7-methyl-1,8-naphthyridin-4(1H)-one
Compound characteristics
| Compound ID: | L859-0265 |
| Compound Name: | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(3-fluorophenyl)methyl]-7-methyl-1,8-naphthyridin-4(1H)-one |
| Molecular Weight: | 446.87 |
| Molecular Formula: | C24 H16 Cl F N4 O2 |
| Smiles: | Cc1ccc2C(C(=CN(Cc3cccc(c3)F)c2n1)c1nc(c2ccc(cc2)[Cl])no1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.1071 |
| logD: | 6.1071 |
| logSw: | -6.0917 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.673 |
| InChI Key: | SSUKWNLYOPGQPR-UHFFFAOYSA-N |