N-(2,5-dimethoxyphenyl)-2-[6-(4-methylphenyl)-2-(methylsulfanyl)-5,7-dioxo-6,7-dihydro[1,3]thiazolo[4,5-d]pyrimidin-4(5H)-yl]acetamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-2-[6-(4-methylphenyl)-2-(methylsulfanyl)-5,7-dioxo-6,7-dihydro[1,3]thiazolo[4,5-d]pyrimidin-4(5H)-yl]acetamide
N-(2,5-dimethoxyphenyl)-2-[6-(4-methylphenyl)-2-(methylsulfanyl)-5,7-dioxo-6,7-dihydro[1,3]thiazolo[4,5-d]pyrimidin-4(5H)-yl]acetamide
Compound characteristics
| Compound ID: | L863-0178 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-2-[6-(4-methylphenyl)-2-(methylsulfanyl)-5,7-dioxo-6,7-dihydro[1,3]thiazolo[4,5-d]pyrimidin-4(5H)-yl]acetamide |
| Molecular Weight: | 498.58 |
| Molecular Formula: | C23 H22 N4 O5 S2 |
| Smiles: | Cc1ccc(cc1)N1C(c2c(nc(SC)s2)N(CC(Nc2cc(ccc2OC)OC)=O)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0681 |
| logD: | 4.0678 |
| logSw: | -4.1694 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.931 |
| InChI Key: | CPBSOKHAFJTKCF-UHFFFAOYSA-N |