2-ethoxy-2-oxoethyl 2-(3-chlorophenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
					Chemical Structure Depiction of
2-ethoxy-2-oxoethyl 2-(3-chlorophenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
			2-ethoxy-2-oxoethyl 2-(3-chlorophenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate
Compound characteristics
| Compound ID: | L867-0619 | 
| Compound Name: | 2-ethoxy-2-oxoethyl 2-(3-chlorophenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylate | 
| Molecular Weight: | 385.8 | 
| Molecular Formula: | C20 H16 Cl N O5 | 
| Smiles: | CCOC(COC(C1=CN(C(c2ccccc12)=O)c1cccc(c1)[Cl])=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.7283 | 
| logD: | 2.7283 | 
| logSw: | -3.5084 | 
| Hydrogen bond acceptors count: | 8 | 
| Polar surface area: | 57.042 | 
| InChI Key: | BXKFDZGXMCGXMA-UHFFFAOYSA-N | 
 
				 
				