6-[(4-fluorophenyl)methyl]-2-{[(3-fluorophenyl)methyl]sulfanyl}-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
6-[(4-fluorophenyl)methyl]-2-{[(3-fluorophenyl)methyl]sulfanyl}-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one
6-[(4-fluorophenyl)methyl]-2-{[(3-fluorophenyl)methyl]sulfanyl}-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | L872-0168 |
| Compound Name: | 6-[(4-fluorophenyl)methyl]-2-{[(3-fluorophenyl)methyl]sulfanyl}-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 399.46 |
| Molecular Formula: | C21 H19 F2 N3 O S |
| Smiles: | C1CN(CC2=C1N=C(NC2=O)SCc1cccc(c1)F)Cc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.2865 |
| logD: | 2.885 |
| logSw: | -3.4628 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.946 |
| InChI Key: | RCYJWZZJLMIUCM-UHFFFAOYSA-N |