N-(3-chloro-4-fluorophenyl)-2-[(2-methylquinazolin-4-yl)oxy]acetamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-2-[(2-methylquinazolin-4-yl)oxy]acetamide
N-(3-chloro-4-fluorophenyl)-2-[(2-methylquinazolin-4-yl)oxy]acetamide
Compound characteristics
| Compound ID: | L874-0058 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-2-[(2-methylquinazolin-4-yl)oxy]acetamide |
| Molecular Weight: | 345.76 |
| Molecular Formula: | C17 H13 Cl F N3 O2 |
| Smiles: | Cc1nc(c2ccccc2n1)OCC(Nc1ccc(c(c1)[Cl])F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8519 |
| logD: | 3.8432 |
| logSw: | -4.1824 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.272 |
| InChI Key: | HEKPBHJZMZZKQJ-UHFFFAOYSA-N |