N-(3,7-dimethyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)-4-fluorobenzamide
Chemical Structure Depiction of
N-(3,7-dimethyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)-4-fluorobenzamide
N-(3,7-dimethyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)-4-fluorobenzamide
Compound characteristics
| Compound ID: | L875-0095 |
| Compound Name: | N-(3,7-dimethyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)-4-fluorobenzamide |
| Molecular Weight: | 317.34 |
| Molecular Formula: | C15 H12 F N3 O2 S |
| Smiles: | CC1=CSC2=NC(C)=C(C(N12)=O)NC(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4423 |
| logD: | -0.5712 |
| logSw: | -2.2566 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.06 |
| InChI Key: | KPCIDSFKONWBGA-UHFFFAOYSA-N |