N-[(2H-1,3-benzodioxol-5-yl)methyl]-5-methyl-3-(4-methylbenzamido)-1H-indole-2-carboxamide
Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-5-methyl-3-(4-methylbenzamido)-1H-indole-2-carboxamide
N-[(2H-1,3-benzodioxol-5-yl)methyl]-5-methyl-3-(4-methylbenzamido)-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | L881-0016 |
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-5-methyl-3-(4-methylbenzamido)-1H-indole-2-carboxamide |
| Molecular Weight: | 441.49 |
| Molecular Formula: | C26 H23 N3 O4 |
| Smiles: | Cc1ccc(cc1)C(Nc1c2cc(C)ccc2[nH]c1C(NCc1ccc2c(c1)OCO2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.03 |
| logD: | 3.9544 |
| logSw: | -4.1551 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 73.582 |
| InChI Key: | RWDJTHYOKUJENB-UHFFFAOYSA-N |