3-[(2-fluorophenyl)carbamoyl]-7-(4-methoxyphenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-5-carboxylic acid
Chemical Structure Depiction of
3-[(2-fluorophenyl)carbamoyl]-7-(4-methoxyphenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-5-carboxylic acid
3-[(2-fluorophenyl)carbamoyl]-7-(4-methoxyphenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-5-carboxylic acid
Compound characteristics
| Compound ID: | L891-0167 |
| Compound Name: | 3-[(2-fluorophenyl)carbamoyl]-7-(4-methoxyphenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-5-carboxylic acid |
| Molecular Weight: | 408.39 |
| Molecular Formula: | C21 H17 F N4 O4 |
| Smiles: | COc1ccc(cc1)C1C=C(C(O)=O)Nc2c(cnn12)C(Nc1ccccc1F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8289 |
| logD: | 0.5805 |
| logSw: | -3.5307 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 83.391 |
| InChI Key: | QSUZHDVLKPSQBP-SFHVURJKSA-N |