7-(4-chlorophenyl)-3-[(4-fluorophenyl)carbamoyl]-4,7-dihydropyrazolo[1,5-a]pyrimidine-5-carboxylic acid
Chemical Structure Depiction of
7-(4-chlorophenyl)-3-[(4-fluorophenyl)carbamoyl]-4,7-dihydropyrazolo[1,5-a]pyrimidine-5-carboxylic acid
7-(4-chlorophenyl)-3-[(4-fluorophenyl)carbamoyl]-4,7-dihydropyrazolo[1,5-a]pyrimidine-5-carboxylic acid
Compound characteristics
| Compound ID: | L891-0182 |
| Compound Name: | 7-(4-chlorophenyl)-3-[(4-fluorophenyl)carbamoyl]-4,7-dihydropyrazolo[1,5-a]pyrimidine-5-carboxylic acid |
| Molecular Weight: | 412.81 |
| Molecular Formula: | C20 H14 Cl F N4 O3 |
| Smiles: | C1C(c2ccc(cc2)[Cl])n2c(c(cn2)C(Nc2ccc(cc2)F)=O)NC=1C(O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.492 |
| logD: | 1.2436 |
| logSw: | -4.1549 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 76.545 |
| InChI Key: | LCBNHTLXSKNJBA-KRWDZBQOSA-N |