2-(4-methoxyphenoxy)-N-[2-methyl-4-(2-methyl-4-oxoquinazolin-3(4H)-yl)phenyl]acetamide
Chemical Structure Depiction of
2-(4-methoxyphenoxy)-N-[2-methyl-4-(2-methyl-4-oxoquinazolin-3(4H)-yl)phenyl]acetamide
2-(4-methoxyphenoxy)-N-[2-methyl-4-(2-methyl-4-oxoquinazolin-3(4H)-yl)phenyl]acetamide
Compound characteristics
| Compound ID: | L892-0147 |
| Compound Name: | 2-(4-methoxyphenoxy)-N-[2-methyl-4-(2-methyl-4-oxoquinazolin-3(4H)-yl)phenyl]acetamide |
| Molecular Weight: | 429.47 |
| Molecular Formula: | C25 H23 N3 O4 |
| Smiles: | CC1=Nc2ccccc2C(N1c1ccc(c(C)c1)NC(COc1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1191 |
| logD: | 2.9699 |
| logSw: | -3.5235 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.997 |
| InChI Key: | ODNOWFKANINHOI-UHFFFAOYSA-N |