N-(4-chlorophenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide
N-(4-chlorophenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | L893-0027 |
| Compound Name: | N-(4-chlorophenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide |
| Molecular Weight: | 422.91 |
| Molecular Formula: | C23 H23 Cl N4 O2 |
| Smiles: | Cc1ccc(cc1)Oc1c(nccn1)N1CCC(CC1)C(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.1458 |
| logD: | 5.1451 |
| logSw: | -5.5179 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.316 |
| InChI Key: | DSEZPRJOLXUTJN-UHFFFAOYSA-N |