[4-(3-chlorophenyl)piperazin-1-yl]{1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidin-4-yl}methanone
Chemical Structure Depiction of
[4-(3-chlorophenyl)piperazin-1-yl]{1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidin-4-yl}methanone
[4-(3-chlorophenyl)piperazin-1-yl]{1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidin-4-yl}methanone
Compound characteristics
| Compound ID: | L893-0505 |
| Compound Name: | [4-(3-chlorophenyl)piperazin-1-yl]{1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidin-4-yl}methanone |
| Molecular Weight: | 492.02 |
| Molecular Formula: | C27 H30 Cl N5 O2 |
| Smiles: | Cc1ccccc1Oc1c(nccn1)N1CCC(CC1)C(N1CCN(CC1)c1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.0905 |
| logD: | 5.0905 |
| logSw: | -5.3645 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.22 |
| InChI Key: | YAXFFTMILVUUSO-UHFFFAOYSA-N |