N-[2-(2-methoxyphenoxy)ethyl]-1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-[2-(2-methoxyphenoxy)ethyl]-1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide
N-[2-(2-methoxyphenoxy)ethyl]-1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | L893-0595 |
| Compound Name: | N-[2-(2-methoxyphenoxy)ethyl]-1-[3-(2-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide |
| Molecular Weight: | 462.55 |
| Molecular Formula: | C26 H30 N4 O4 |
| Smiles: | Cc1ccccc1Oc1c(nccn1)N1CCC(CC1)C(NCCOc1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.274 |
| logD: | 4.274 |
| logSw: | -4.3362 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.701 |
| InChI Key: | ICLZZSXMTFGKPT-UHFFFAOYSA-N |