N-(4-bromophenyl)-1-[3-(3-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(4-bromophenyl)-1-[3-(3-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide
N-(4-bromophenyl)-1-[3-(3-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | L893-0844 |
| Compound Name: | N-(4-bromophenyl)-1-[3-(3-methylphenoxy)pyrazin-2-yl]piperidine-4-carboxamide |
| Molecular Weight: | 467.36 |
| Molecular Formula: | C23 H23 Br N4 O2 |
| Smiles: | Cc1cccc(c1)Oc1c(nccn1)N1CCC(CC1)C(Nc1ccc(cc1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.3668 |
| logD: | 5.3662 |
| logSw: | -5.3424 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.316 |
| InChI Key: | NHVVCMQPSBIQNM-UHFFFAOYSA-N |