N-(3,5-dimethylphenyl)-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3,5-dimethylphenyl)-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-4-carboxamide
N-(3,5-dimethylphenyl)-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | L894-0286 |
| Compound Name: | N-(3,5-dimethylphenyl)-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-4-carboxamide |
| Molecular Weight: | 418.56 |
| Molecular Formula: | C24 H26 N4 O S |
| Smiles: | Cc1cc(C)cc(c1)NC(C1CCN(CC1)c1c(nccn1)Sc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8827 |
| logD: | 4.8827 |
| logSw: | -4.5383 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.671 |
| InChI Key: | ZGBCBAQFINAUHZ-UHFFFAOYSA-N |