N-(3-chlorophenyl)-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide
N-(3-chlorophenyl)-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide
Compound characteristics
| Compound ID: | L895-0023 |
| Compound Name: | N-(3-chlorophenyl)-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide |
| Molecular Weight: | 438.98 |
| Molecular Formula: | C23 H23 Cl N4 O S |
| Smiles: | Cc1ccc(cc1)Sc1c(nccn1)N1CCCC(C1)C(Nc1cccc(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3968 |
| logD: | 5.3957 |
| logSw: | -5.8103 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.604 |
| InChI Key: | GYCUFSXRUVGTNV-KRWDZBQOSA-N |