N-(2,5-dimethylphenyl)-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide
N-(2,5-dimethylphenyl)-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide
Compound characteristics
| Compound ID: | L895-0059 |
| Compound Name: | N-(2,5-dimethylphenyl)-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide |
| Molecular Weight: | 432.59 |
| Molecular Formula: | C25 H28 N4 O S |
| Smiles: | Cc1ccc(cc1)Sc1c(nccn1)N1CCCC(C1)C(Nc1cc(C)ccc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.983 |
| logD: | 4.983 |
| logSw: | -4.5699 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.906 |
| InChI Key: | NSJARNNMXHZTLQ-FQEVSTJZSA-N |