N-[(2,4-difluorophenyl)methyl]-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide
Chemical Structure Depiction of
N-[(2,4-difluorophenyl)methyl]-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide
N-[(2,4-difluorophenyl)methyl]-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide
Compound characteristics
| Compound ID: | L895-0131 |
| Compound Name: | N-[(2,4-difluorophenyl)methyl]-1-{3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}piperidine-3-carboxamide |
| Molecular Weight: | 454.54 |
| Molecular Formula: | C24 H24 F2 N4 O S |
| Smiles: | Cc1ccc(cc1)Sc1c(nccn1)N1CCCC(C1)C(NCc1ccc(cc1F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7459 |
| logD: | 4.7459 |
| logSw: | -4.5532 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.926 |
| InChI Key: | UQODIVLLEFDGER-SFHVURJKSA-N |