N-phenyl-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-3-carboxamide
Chemical Structure Depiction of
N-phenyl-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-3-carboxamide
N-phenyl-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | L895-0381 |
| Compound Name: | N-phenyl-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-3-carboxamide |
| Molecular Weight: | 390.51 |
| Molecular Formula: | C22 H22 N4 O S |
| Smiles: | C1CC(CN(C1)c1c(nccn1)Sc1ccccc1)C(Nc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8431 |
| logD: | 3.843 |
| logSw: | -3.9461 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.604 |
| InChI Key: | VMGURMAFRUQAMD-KRWDZBQOSA-N |