N-[(3,4-dimethoxyphenyl)methyl]-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-3-carboxamide
Chemical Structure Depiction of
N-[(3,4-dimethoxyphenyl)methyl]-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-3-carboxamide
N-[(3,4-dimethoxyphenyl)methyl]-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | L895-0409 |
| Compound Name: | N-[(3,4-dimethoxyphenyl)methyl]-1-[3-(phenylsulfanyl)pyrazin-2-yl]piperidine-3-carboxamide |
| Molecular Weight: | 464.59 |
| Molecular Formula: | C25 H28 N4 O3 S |
| Smiles: | COc1ccc(CNC(C2CCCN(C2)c2c(nccn2)Sc2ccccc2)=O)cc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3385 |
| logD: | 3.3385 |
| logSw: | -3.6272 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.187 |
| InChI Key: | UFJALUNHRDQHTO-IBGZPJMESA-N |