1-[4-(4-methylphenyl)piperazin-1-yl]-2-({3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)ethan-1-one
Chemical Structure Depiction of
1-[4-(4-methylphenyl)piperazin-1-yl]-2-({3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)ethan-1-one
1-[4-(4-methylphenyl)piperazin-1-yl]-2-({3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)ethan-1-one
Compound characteristics
| Compound ID: | L898-0169 |
| Compound Name: | 1-[4-(4-methylphenyl)piperazin-1-yl]-2-({3-[(4-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)ethan-1-one |
| Molecular Weight: | 450.62 |
| Molecular Formula: | C24 H26 N4 O S2 |
| Smiles: | Cc1ccc(cc1)N1CCN(CC1)C(CSc1c(nccn1)Sc1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0269 |
| logD: | 5.0268 |
| logSw: | -4.5845 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 37.707 |
| InChI Key: | YRAVJTLGWZADTN-UHFFFAOYSA-N |