N-(4-fluoro-3-methylphenyl)-2-{[3-(phenylsulfanyl)pyrazin-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(4-fluoro-3-methylphenyl)-2-{[3-(phenylsulfanyl)pyrazin-2-yl]sulfanyl}acetamide
N-(4-fluoro-3-methylphenyl)-2-{[3-(phenylsulfanyl)pyrazin-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | L898-0372 |
| Compound Name: | N-(4-fluoro-3-methylphenyl)-2-{[3-(phenylsulfanyl)pyrazin-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 385.48 |
| Molecular Formula: | C19 H16 F N3 O S2 |
| Smiles: | Cc1cc(ccc1F)NC(CSc1c(nccn1)Sc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4333 |
| logD: | 4.4332 |
| logSw: | -4.2922 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.203 |
| InChI Key: | HQJGZSKVRLNVJA-UHFFFAOYSA-N |