N-(2-methoxyethyl)-2-({3-[(2-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(2-methoxyethyl)-2-({3-[(2-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)acetamide
N-(2-methoxyethyl)-2-({3-[(2-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | L898-0753 |
| Compound Name: | N-(2-methoxyethyl)-2-({3-[(2-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 349.47 |
| Molecular Formula: | C16 H19 N3 O2 S2 |
| Smiles: | Cc1ccccc1Sc1c(nccn1)SCC(NCCOC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3514 |
| logD: | 2.3514 |
| logSw: | -2.5372 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.981 |
| InChI Key: | XXDJFKJMMGNDAN-UHFFFAOYSA-N |