1-(4-ethylpiperazin-1-yl)-2-({3-[(3-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)ethan-1-one
Chemical Structure Depiction of
1-(4-ethylpiperazin-1-yl)-2-({3-[(3-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)ethan-1-one
1-(4-ethylpiperazin-1-yl)-2-({3-[(3-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)ethan-1-one
Compound characteristics
| Compound ID: | L898-1174 |
| Compound Name: | 1-(4-ethylpiperazin-1-yl)-2-({3-[(3-methylphenyl)sulfanyl]pyrazin-2-yl}sulfanyl)ethan-1-one |
| Molecular Weight: | 388.55 |
| Molecular Formula: | C19 H24 N4 O S2 |
| Smiles: | CCN1CCN(CC1)C(CSc1c(nccn1)Sc1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8404 |
| logD: | 2.7214 |
| logSw: | -2.9607 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 37.983 |
| InChI Key: | MBBJVDGHSWFMKN-UHFFFAOYSA-N |