2-{[3-(4-methylphenoxy)pyrazin-2-yl]sulfanyl}-N-(4-phenylbutan-2-yl)acetamide
Chemical Structure Depiction of
2-{[3-(4-methylphenoxy)pyrazin-2-yl]sulfanyl}-N-(4-phenylbutan-2-yl)acetamide
2-{[3-(4-methylphenoxy)pyrazin-2-yl]sulfanyl}-N-(4-phenylbutan-2-yl)acetamide
Compound characteristics
| Compound ID: | L899-0123 |
| Compound Name: | 2-{[3-(4-methylphenoxy)pyrazin-2-yl]sulfanyl}-N-(4-phenylbutan-2-yl)acetamide |
| Molecular Weight: | 407.53 |
| Molecular Formula: | C23 H25 N3 O2 S |
| Smiles: | CC(CCc1ccccc1)NC(CSc1c(nccn1)Oc1ccc(C)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9623 |
| logD: | 4.9623 |
| logSw: | -4.6512 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.612 |
| InChI Key: | KGMXFYXNZKBEID-SFHVURJKSA-N |