N-(4-ethylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide
N-(4-ethylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | L900-0043 |
| Compound Name: | N-(4-ethylphenyl)-1-[3-(4-methylphenoxy)pyrazin-2-yl]piperidine-3-carboxamide |
| Molecular Weight: | 416.52 |
| Molecular Formula: | C25 H28 N4 O2 |
| Smiles: | CCc1ccc(cc1)NC(C1CCCN(C1)c1c(nccn1)Oc1ccc(C)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3267 |
| logD: | 5.3267 |
| logSw: | -5.1094 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.25 |
| InChI Key: | XWYLJLONTBXTDC-FQEVSTJZSA-N |