N-[(3,4-diethoxyphenyl)methyl]-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide
Chemical Structure Depiction of
N-[(3,4-diethoxyphenyl)methyl]-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide
N-[(3,4-diethoxyphenyl)methyl]-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | L900-0428 |
| Compound Name: | N-[(3,4-diethoxyphenyl)methyl]-1-(3-phenoxypyrazin-2-yl)piperidine-3-carboxamide |
| Molecular Weight: | 476.58 |
| Molecular Formula: | C27 H32 N4 O4 |
| Smiles: | CCOc1ccc(CNC(C2CCCN(C2)c2c(nccn2)Oc2ccccc2)=O)cc1OCC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7391 |
| logD: | 3.7391 |
| logSw: | -3.8929 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.992 |
| InChI Key: | FOUVKTWKEZINQZ-NRFANRHFSA-N |