(2-{[3-(4-methylphenoxy)pyrazin-2-yl]sulfanyl}phenyl)(4-methylpiperazin-1-yl)methanone
Chemical Structure Depiction of
(2-{[3-(4-methylphenoxy)pyrazin-2-yl]sulfanyl}phenyl)(4-methylpiperazin-1-yl)methanone
(2-{[3-(4-methylphenoxy)pyrazin-2-yl]sulfanyl}phenyl)(4-methylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | L901-0070 |
| Compound Name: | (2-{[3-(4-methylphenoxy)pyrazin-2-yl]sulfanyl}phenyl)(4-methylpiperazin-1-yl)methanone |
| Molecular Weight: | 420.53 |
| Molecular Formula: | C23 H24 N4 O2 S |
| Smiles: | Cc1ccc(cc1)Oc1c(nccn1)Sc1ccccc1C(N1CCN(C)CC1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8149 |
| logD: | 3.6843 |
| logSw: | -3.8947 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 45.824 |
| InChI Key: | MIEGUJOQFLSENO-UHFFFAOYSA-N |