4-acetyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-acetyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzene-1-sulfonamide
4-acetyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | L904-3417 |
| Compound Name: | 4-acetyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzene-1-sulfonamide |
| Molecular Weight: | 422.52 |
| Molecular Formula: | C22 H18 N2 O3 S2 |
| Smiles: | CC(c1ccc(cc1)S(Nc1ccc(cc1)c1nc2ccc(C)cc2s1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.921 |
| logD: | 4.9148 |
| logSw: | -4.6663 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.164 |
| InChI Key: | IOIRYVSVMIMXII-UHFFFAOYSA-N |