1-(3-fluorophenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]methanesulfonamide
Chemical Structure Depiction of
1-(3-fluorophenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]methanesulfonamide
1-(3-fluorophenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]methanesulfonamide
Compound characteristics
| Compound ID: | L904-3449 |
| Compound Name: | 1-(3-fluorophenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]methanesulfonamide |
| Molecular Weight: | 412.5 |
| Molecular Formula: | C21 H17 F N2 O2 S2 |
| Smiles: | Cc1ccc2c(c1)sc(c1ccc(cc1)NS(Cc1cccc(c1)F)(=O)=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 5.6784 |
| logD: | 5.6705 |
| logSw: | -5.5377 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.964 |
| InChI Key: | HUXLCKPDDLRXPR-UHFFFAOYSA-N |