N-{4-[4-(2,5-dimethylphenyl)-1,3-oxazol-2-yl]phenyl}-3-methylthiophene-2-carboxamide
Chemical Structure Depiction of
N-{4-[4-(2,5-dimethylphenyl)-1,3-oxazol-2-yl]phenyl}-3-methylthiophene-2-carboxamide
N-{4-[4-(2,5-dimethylphenyl)-1,3-oxazol-2-yl]phenyl}-3-methylthiophene-2-carboxamide
Compound characteristics
| Compound ID: | L906-0309 |
| Compound Name: | N-{4-[4-(2,5-dimethylphenyl)-1,3-oxazol-2-yl]phenyl}-3-methylthiophene-2-carboxamide |
| Molecular Weight: | 388.49 |
| Molecular Formula: | C23 H20 N2 O2 S |
| Smiles: | Cc1ccc(C)c(c1)c1coc(c2ccc(cc2)NC(c2c(C)ccs2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.8465 |
| logD: | 5.8465 |
| logSw: | -5.4517 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.545 |
| InChI Key: | YAQPWSSHPSHPQD-UHFFFAOYSA-N |