N-[(2-ethoxyphenyl)methyl]-3-[(5-methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
Chemical Structure Depiction of
N-[(2-ethoxyphenyl)methyl]-3-[(5-methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
N-[(2-ethoxyphenyl)methyl]-3-[(5-methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)methyl]-1,2,4-oxadiazole-5-carboxamide
Compound characteristics
| Compound ID: | L914-0657 |
| Compound Name: | N-[(2-ethoxyphenyl)methyl]-3-[(5-methyl-2-oxo-1,3-benzoxazol-3(2H)-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| Molecular Weight: | 408.41 |
| Molecular Formula: | C21 H20 N4 O5 |
| Smiles: | CCOc1ccccc1CNC(c1nc(CN2C(=O)Oc3ccc(C)cc23)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2232 |
| logD: | 3.2232 |
| logSw: | -3.5328 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.63 |
| InChI Key: | AWHXODBUBQKXAZ-UHFFFAOYSA-N |