1-(4-fluorobenzene-1-sulfonyl)-4-(5-phenyl-1,2,4-oxadiazol-3-yl)piperidine
Chemical Structure Depiction of
1-(4-fluorobenzene-1-sulfonyl)-4-(5-phenyl-1,2,4-oxadiazol-3-yl)piperidine
1-(4-fluorobenzene-1-sulfonyl)-4-(5-phenyl-1,2,4-oxadiazol-3-yl)piperidine
Compound characteristics
| Compound ID: | L918-1708 |
| Compound Name: | 1-(4-fluorobenzene-1-sulfonyl)-4-(5-phenyl-1,2,4-oxadiazol-3-yl)piperidine |
| Molecular Weight: | 387.43 |
| Molecular Formula: | C19 H18 F N3 O3 S |
| Smiles: | C1CN(CCC1c1nc(c2ccccc2)on1)S(c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9078 |
| logD: | 3.9078 |
| logSw: | -4.0314 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.355 |
| InChI Key: | QBRJJJZSGZGGJC-UHFFFAOYSA-N |