1-(3-chloro-4-methoxybenzene-1-sulfonyl)-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]piperidine
Chemical Structure Depiction of
1-(3-chloro-4-methoxybenzene-1-sulfonyl)-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]piperidine
1-(3-chloro-4-methoxybenzene-1-sulfonyl)-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]piperidine
Compound characteristics
| Compound ID: | L918-1788 |
| Compound Name: | 1-(3-chloro-4-methoxybenzene-1-sulfonyl)-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]piperidine |
| Molecular Weight: | 447.94 |
| Molecular Formula: | C21 H22 Cl N3 O4 S |
| Smiles: | Cc1ccc(cc1)c1nc(C2CCN(CC2)S(c2ccc(c(c2)[Cl])OC)(=O)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.6837 |
| logD: | 4.6837 |
| logSw: | -4.9732 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 70.986 |
| InChI Key: | NKIAKNBEJRAPFO-UHFFFAOYSA-N |