1-(diphenylmethyl)-4-[4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl]piperazine
Chemical Structure Depiction of
1-(diphenylmethyl)-4-[4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl]piperazine
1-(diphenylmethyl)-4-[4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl]piperazine
Compound characteristics
| Compound ID: | L923-0381 |
| Compound Name: | 1-(diphenylmethyl)-4-[4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl]piperazine |
| Molecular Weight: | 479.62 |
| Molecular Formula: | C25 H25 N3 O3 S2 |
| Smiles: | Cc1cc(c2cc(sc2)S(N2CCN(CC2)C(c2ccccc2)c2ccccc2)(=O)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.9185 |
| logD: | 4.9175 |
| logSw: | -4.6657 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.871 |
| InChI Key: | JGEZJSHDLUFUFG-UHFFFAOYSA-N |