N-{3-[ethyl(phenyl)amino]propyl}-4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-{3-[ethyl(phenyl)amino]propyl}-4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
N-{3-[ethyl(phenyl)amino]propyl}-4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | L923-0551 |
| Compound Name: | N-{3-[ethyl(phenyl)amino]propyl}-4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 405.54 |
| Molecular Formula: | C19 H23 N3 O3 S2 |
| Smiles: | CCN(CCCNS(c1cc(cs1)c1cc(C)no1)(=O)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.9778 |
| logD: | 3.9669 |
| logSw: | -3.867 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.188 |
| InChI Key: | XXDQDEONWITIMF-UHFFFAOYSA-N |