N-ethyl-N-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-ethyl-N-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
N-ethyl-N-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | L923-0572 |
| Compound Name: | N-ethyl-N-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 378.47 |
| Molecular Formula: | C17 H18 N2 O4 S2 |
| Smiles: | CCN(c1ccc(cc1)OC)S(c1cc(cs1)c1cc(C)no1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5786 |
| logD: | 3.5786 |
| logSw: | -3.6792 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.692 |
| InChI Key: | DFAWZACLQGEMEH-UHFFFAOYSA-N |