1-(4-chlorophenyl)-4-[4-(3-ethyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl]piperazine
Chemical Structure Depiction of
1-(4-chlorophenyl)-4-[4-(3-ethyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl]piperazine
1-(4-chlorophenyl)-4-[4-(3-ethyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl]piperazine
Compound characteristics
| Compound ID: | L923-0674 |
| Compound Name: | 1-(4-chlorophenyl)-4-[4-(3-ethyl-1,2-oxazol-5-yl)thiophene-2-sulfonyl]piperazine |
| Molecular Weight: | 437.97 |
| Molecular Formula: | C19 H20 Cl N3 O3 S2 |
| Smiles: | CCc1cc(c2cc(sc2)S(N2CCN(CC2)c2ccc(cc2)[Cl])(=O)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.5786 |
| logD: | 4.5786 |
| logSw: | -4.7216 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.259 |
| InChI Key: | WIWILVODKGLNHM-UHFFFAOYSA-N |