N-(3-chloro-4-methylphenyl)-4-(3-ethyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-4-(3-ethyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
N-(3-chloro-4-methylphenyl)-4-(3-ethyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | L923-0726 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-4-(3-ethyl-1,2-oxazol-5-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 382.89 |
| Molecular Formula: | C16 H15 Cl N2 O3 S2 |
| Smiles: | CCc1cc(c2cc(sc2)S(Nc2ccc(C)c(c2)[Cl])(=O)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.3334 |
| logD: | 4.984 |
| logSw: | -6.0708 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.937 |
| InChI Key: | ZTAQNAPJQYGKBV-UHFFFAOYSA-N |