N-(2-bromophenyl)-4-(1-ethyl-1H-pyrazol-5-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(2-bromophenyl)-4-(1-ethyl-1H-pyrazol-5-yl)thiophene-2-sulfonamide
N-(2-bromophenyl)-4-(1-ethyl-1H-pyrazol-5-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | L924-1044 |
| Compound Name: | N-(2-bromophenyl)-4-(1-ethyl-1H-pyrazol-5-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 412.32 |
| Molecular Formula: | C15 H14 Br N3 O2 S2 |
| Smiles: | CCn1c(ccn1)c1cc(sc1)S(Nc1ccccc1[Br])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.505 |
| logD: | 3.457 |
| logSw: | -3.7182 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.026 |
| InChI Key: | BELWSTPDJLOPJW-UHFFFAOYSA-N |