2-[4-(morpholin-4-yl)-7-phenyl-5H-pyrrolo[3,2-d]pyrimidin-5-yl]-1-(4-phenylpiperazin-1-yl)ethan-1-one
Chemical Structure Depiction of
2-[4-(morpholin-4-yl)-7-phenyl-5H-pyrrolo[3,2-d]pyrimidin-5-yl]-1-(4-phenylpiperazin-1-yl)ethan-1-one
2-[4-(morpholin-4-yl)-7-phenyl-5H-pyrrolo[3,2-d]pyrimidin-5-yl]-1-(4-phenylpiperazin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | L936-0196 |
| Compound Name: | 2-[4-(morpholin-4-yl)-7-phenyl-5H-pyrrolo[3,2-d]pyrimidin-5-yl]-1-(4-phenylpiperazin-1-yl)ethan-1-one |
| Molecular Weight: | 482.59 |
| Molecular Formula: | C28 H30 N6 O2 |
| Smiles: | C1CN(CCN1C(Cn1cc(c2ccccc2)c2c1c(ncn2)N1CCOCC1)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.4718 |
| logD: | 2.1512 |
| logSw: | -3.4013 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 52.989 |
| InChI Key: | GOLITNWKFRSLFN-UHFFFAOYSA-N |