5-amino-1-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}-N-[4-(trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
5-amino-1-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}-N-[4-(trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxamide
5-amino-1-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}-N-[4-(trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | L937-0234 |
| Compound Name: | 5-amino-1-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl}-N-[4-(trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 456.43 |
| Molecular Formula: | C22 H19 F3 N6 O2 |
| Smiles: | Cc1ccc(cc1)c1nc(Cn2c(c(C(Nc3ccc(cc3)C(F)(F)F)=O)nn2)N)c(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.9419 |
| logD: | 3.9419 |
| logSw: | -4.144 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 87.41 |
| InChI Key: | IWYFEQVXEUAUJU-UHFFFAOYSA-N |