{2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl}(3-methylthiophen-2-yl)methanone
Chemical Structure Depiction of
{2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl}(3-methylthiophen-2-yl)methanone
{2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl}(3-methylthiophen-2-yl)methanone
Compound characteristics
| Compound ID: | L948-2811 |
| Compound Name: | {2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl}(3-methylthiophen-2-yl)methanone |
| Molecular Weight: | 369.44 |
| Molecular Formula: | C19 H19 N3 O3 S |
| Smiles: | Cc1ccsc1C(N1CCCC1c1nc(c2ccc(cc2)OC)no1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2806 |
| logD: | 4.2806 |
| logSw: | -4.1672 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.915 |
| InChI Key: | SVJRVJQIMHOVSW-HNNXBMFYSA-N |