2-(4-fluorophenyl)-1-{2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl}ethan-1-one
Chemical Structure Depiction of
2-(4-fluorophenyl)-1-{2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl}ethan-1-one
2-(4-fluorophenyl)-1-{2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | L948-3083 |
| Compound Name: | 2-(4-fluorophenyl)-1-{2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl}ethan-1-one |
| Molecular Weight: | 381.41 |
| Molecular Formula: | C21 H20 F N3 O3 |
| Smiles: | COc1ccccc1c1nc(C2CCCN2C(Cc2ccc(cc2)F)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6707 |
| logD: | 3.6707 |
| logSw: | -3.9423 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.456 |
| InChI Key: | BPLBVZCWYWHYAP-KRWDZBQOSA-N |