N-(2-fluorophenyl)-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxamide
N-(2-fluorophenyl)-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxamide
Compound characteristics
| Compound ID: | L949-2776 |
| Compound Name: | N-(2-fluorophenyl)-2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxamide |
| Molecular Weight: | 382.39 |
| Molecular Formula: | C20 H19 F N4 O3 |
| Smiles: | COc1cccc(c1)c1nc(C2CCCN2C(Nc2ccccc2F)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4016 |
| logD: | 4.4016 |
| logSw: | -4.2821 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.019 |
| InChI Key: | USJQDJQVZKAKFL-KRWDZBQOSA-N |